C35H34CoN3O3- — CID 173471335
oxocobalt;pyrrol-1-ide-2,5-dione;1,3,3-trimethyl-2-[2-phenyl-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole (PubChem CID 173471335) has the molecular formula C35H34CoN3O3- and a molecular weight of 603.61 g/mol. Its IUPAC name is oxocobalt;pyrrol-1-ide-2,5-dione;1,3,3-trimethyl-2-[2-phenyl-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole.
| Compound Name | oxocobalt;pyrrol-1-ide-2,5-dione;1,3,3-trimethyl-2-[2-phenyl-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
|---|---|
| PubChem CID | 173471335 |
| Molecular Formula | C35H34CoN3O3- |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | oxocobalt;pyrrol-1-ide-2,5-dione;1,3,3-trimethyl-2-[2-phenyl-3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
| SMILES | CN1C(=CC(=CC2=[N+](C)c3ccccc3C2(C)C)c2cc[c-]cc2)C(C)(C)c2ccccc21.O=C1C=CC(=O)[N-]1.O=[Co] |
| InChI | InChI=1S/C31H32N2.C4H3NO2.Co.O/c1-30(2)24-16-10-12-18-26(24)32(5)28(30)20-23(22-14-8-7-9-15-22)21-29-31(3,4)25-17-11-13-19-27(25)33(29)6;6-3-1-2-4(7)5-3;;/h8-21H,1-6H3;1-2H,(H,5,6,7);;/p-1 |
| InChIKey | GCDFUIDSQWYEEG-UHFFFAOYSA-M |
| XLogP | 6.75 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|