About 1-aminoethoxymethanol
1-aminoethoxymethanol (PubChem CID 76727864) has the molecular formula C3H9NO2
and a molecular weight of 91.11 g/mol. Its IUPAC name is 1-aminoethoxymethanol.
Molecular Properties
| Compound Name | 1-aminoethoxymethanol |
| PubChem CID | 76727864 |
| Molecular Formula | C3H9NO2 |
| Molecular Weight | 91.11 g/mol |
| Exact Mass | 91.06 |
| IUPAC Name | 1-aminoethoxymethanol |
| SMILES | CC(N)OCO |
| InChI | InChI=1S/C3H9NO2/c1-3(4)6-2-5/h3,5H,2,4H2,1H3 |
| InChIKey | UVDFGERAIQSATO-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.11 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethoxymethanol?
The IUPAC name of 1-aminoethoxymethanol (CID 76727864) is 1-aminoethoxymethanol.
What is the SMILES notation for 1-aminoethoxymethanol?
The canonical SMILES for 1-aminoethoxymethanol is CC(N)OCO.
What is the InChIKey of 1-aminoethoxymethanol?
The InChIKey is UVDFGERAIQSATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO2/c1-3(4)6-2-5/h3,5H,2,4H2,1H3.
What are the key properties of 1-aminoethoxymethanol?
1-aminoethoxymethanol has a molecular weight of 91.11 g/mol, XLogP of -0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethoxymethanol is sourced from PubChem (CID 76727864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).