C17H16O3 — CID 767354
(4aS,8aS)-3-benzyl-4-methoxy-4a,8a-dihydrochromen-2-one (PubChem CID 767354) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is (4aS,8aS)-3-benzyl-4-methoxy-4a,8a-dihydrochromen-2-one.
| Compound Name | (4aS,8aS)-3-benzyl-4-methoxy-4a,8a-dihydrochromen-2-one |
|---|---|
| PubChem CID | 767354 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (4aS,8aS)-3-benzyl-4-methoxy-4a,8a-dihydrochromen-2-one |
| SMILES | COC1=C(Cc2ccccc2)C(=O)O[C@H]2C=CC=C[C@H]12 |
| InChI | InChI=1S/C17H16O3/c1-19-16-13-9-5-6-10-15(13)20-17(18)14(16)11-12-7-3-2-4-8-12/h2-10,13,15H,11H2,1H3/t13-,15-/m0/s1 |
| InChIKey | UYNKEULYIVASCJ-ZFWWWQNUSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |