C15H17NO3 — CID 14615267
6-benzyl-5-methoxy-3,3-dimethyl-1H-pyridine-2,4-dione (PubChem CID 14615267) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 6-benzyl-5-methoxy-3,3-dimethyl-1H-pyridine-2,4-dione.
| Compound Name | 6-benzyl-5-methoxy-3,3-dimethyl-1H-pyridine-2,4-dione |
|---|---|
| PubChem CID | 14615267 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 6-benzyl-5-methoxy-3,3-dimethyl-1H-pyridine-2,4-dione |
| SMILES | COC1=C(Cc2ccccc2)NC(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C15H17NO3/c1-15(2)13(17)12(19-3)11(16-14(15)18)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,16,18) |
| InChIKey | WIIGLQGMNFQUIZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|