C19H17NO3 — CID 14119550
2-benzoyl-5-benzyl-4-methyl-2,3-dihydro-1,3-oxazin-6-one (PubChem CID 14119550) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-benzoyl-5-benzyl-4-methyl-2,3-dihydro-1,3-oxazin-6-one.
| Compound Name | 2-benzoyl-5-benzyl-4-methyl-2,3-dihydro-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 14119550 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-benzoyl-5-benzyl-4-methyl-2,3-dihydro-1,3-oxazin-6-one |
| SMILES | CC1=C(Cc2ccccc2)C(=O)OC(C(=O)c2ccccc2)N1 |
| InChI | InChI=1S/C19H17NO3/c1-13-16(12-14-8-4-2-5-9-14)19(22)23-18(20-13)17(21)15-10-6-3-7-11-15/h2-11,18,20H,12H2,1H3 |
| InChIKey | AVPBZICZZKOSCH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |