C19H25BrO5 — CID 7675142
[2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7675142) has the molecular formula C19H25BrO5 and a molecular weight of 413.31 g/mol. Its IUPAC name is [2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7675142 |
| Molecular Formula | C19H25BrO5 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OC(=O)COC(=O)/C=C/c1ccc(Br)o1 |
| InChI | InChI=1S/C19H25BrO5/c1-12(2)15-7-4-13(3)10-16(15)25-19(22)11-23-18(21)9-6-14-5-8-17(20)24-14/h5-6,8-9,12-13,15-16H,4,7,10-11H2,1-3H3/b9-6+/t13-,15-,16-/m1/s1 |
| InChIKey | FYOSXYPMNZEHJT-ABGBKTSJSA-N |
| XLogP | 4.60 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|