C21H34O5 — CID 76787670
3-methyl-3,4-bis(3-methylbut-2-enoxy)-5-(3-methylbut-2-enoxymethyl)oxolan-2-one (PubChem CID 76787670) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 3-methyl-3,4-bis(3-methylbut-2-enoxy)-5-(3-methylbut-2-enoxymethyl)oxolan-2-one.
| Compound Name | 3-methyl-3,4-bis(3-methylbut-2-enoxy)-5-(3-methylbut-2-enoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 76787670 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 3-methyl-3,4-bis(3-methylbut-2-enoxy)-5-(3-methylbut-2-enoxymethyl)oxolan-2-one |
| SMILES | CC(C)=CCOCC1OC(=O)C(C)(OCC=C(C)C)C1OCC=C(C)C |
| InChI | InChI=1S/C21H34O5/c1-15(2)8-11-23-14-18-19(24-12-9-16(3)4)21(7,20(22)26-18)25-13-10-17(5)6/h8-10,18-19H,11-14H2,1-7H3 |
| InChIKey | STJSHKIVVQJKEQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|