C22H24ClFN4O5 — CID 76820973
methyl 2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazinan-1-yl]acetate (PubChem CID 76820973) has the molecular formula C22H24ClFN4O5 and a molecular weight of 478.91 g/mol. Its IUPAC name is methyl 2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazinan-1-yl]acetate.
| Compound Name | methyl 2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazinan-1-yl]acetate |
|---|---|
| PubChem CID | 76820973 |
| Molecular Formula | C22H24ClFN4O5 |
| Molecular Weight | 478.91 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | methyl 2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazinan-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)NC(Nc2ccc(OC(C)C)c(F)c2)N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C22H24ClFN4O5/c1-13(2)33-18-9-8-16(10-17(18)24)25-20-26-21(30)28(12-19(29)32-3)22(31)27(20)11-14-4-6-15(23)7-5-14/h4-10,13,20,25H,11-12H2,1-3H3,(H,26,30) |
| InChIKey | PHFXLRGOPYRBKR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|