C21H24ClFN4O3 — CID 76821275
1-[(4-chlorophenyl)methyl]-3-ethyl-6-(3-fluoro-4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione (PubChem CID 76821275) has the molecular formula C21H24ClFN4O3 and a molecular weight of 434.90 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-ethyl-6-(3-fluoro-4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-6-(3-fluoro-4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 76821275 |
| Molecular Formula | C21H24ClFN4O3 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-6-(3-fluoro-4-propan-2-yloxyanilino)-1,3,5-triazinane-2,4-dione |
| SMILES | CCN1C(=O)NC(Nc2ccc(OC(C)C)c(F)c2)N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C21H24ClFN4O3/c1-4-26-20(28)25-19(24-16-9-10-18(17(23)11-16)30-13(2)3)27(21(26)29)12-14-5-7-15(22)8-6-14/h5-11,13,19,24H,4,12H2,1-3H3,(H,25,28) |
| InChIKey | QFALWYBGQAFDBE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|