C10H14BrN4O4+ — CID 76845703
8-bromo-7-(2,3-dihydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 76845703) has the molecular formula C10H14BrN4O4+ and a molecular weight of 334.15 g/mol. Its IUPAC name is 8-bromo-7-(2,3-dihydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-bromo-7-(2,3-dihydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 76845703 |
| Molecular Formula | C10H14BrN4O4+ |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 8-bromo-7-(2,3-dihydroxypropyl)-1,3-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(Br)=[N+]2CC(O)CO)N(C)C1=O |
| InChI | InChI=1S/C10H14BrN4O4/c1-13-7-6(8(18)14(2)10(13)19)15(9(11)12-7)3-5(17)4-16/h5-6,16-17H,3-4H2,1-2H3/q+1 |
| InChIKey | YDLNDGSMLURXBU-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|