C17H17ClINO4 — CID 76866265
N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(5-iodofuran-2-yl)prop-2-enamide (PubChem CID 76866265) has the molecular formula C17H17ClINO4 and a molecular weight of 461.68 g/mol. Its IUPAC name is N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(5-iodofuran-2-yl)prop-2-enamide.
| Compound Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(5-iodofuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 76866265 |
| Molecular Formula | C17H17ClINO4 |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | N-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-3-(5-iodofuran-2-yl)prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(CNC(=O)C=Cc2ccc(I)o2)cc1OC |
| InChI | InChI=1S/C17H17ClINO4/c1-3-23-17-13(18)8-11(9-14(17)22-2)10-20-16(21)7-5-12-4-6-15(19)24-12/h4-9H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | KSDNJCJVKJJGLN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|