C24H27N3O3S — CID 76869180
3-[1-benzyl-3-(3,4-dimethylphenyl)pyrazol-4-yl]-N-(2-methylsulfonylethyl)prop-2-enamide (PubChem CID 76869180) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-[1-benzyl-3-(3,4-dimethylphenyl)pyrazol-4-yl]-N-(2-methylsulfonylethyl)prop-2-enamide.
| Compound Name | 3-[1-benzyl-3-(3,4-dimethylphenyl)pyrazol-4-yl]-N-(2-methylsulfonylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 76869180 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 3-[1-benzyl-3-(3,4-dimethylphenyl)pyrazol-4-yl]-N-(2-methylsulfonylethyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2nn(Cc3ccccc3)cc2C=CC(=O)NCCS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C24H27N3O3S/c1-18-9-10-21(15-19(18)2)24-22(11-12-23(28)25-13-14-31(3,29)30)17-27(26-24)16-20-7-5-4-6-8-20/h4-12,15,17H,13-14,16H2,1-3H3,(H,25,28) |
| InChIKey | FLKBCLBMOGZZTH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|