4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid

C12H10O4 — CID 77054962

IUPAC4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid
SMILESO=C(O)C=CC(=O)c1ccc2c(c1)COC2
InChIInChI=1S/C12H10O4/c13-11(3-4-12(14)15)8-1-2-9-6-16-7-10(9)5-8/h1-5H,6-7H2,(H,14,15)
InChIKeyRIMSVIRRANUSRG-UHFFFAOYSA-N
MW218.21 g/mol
LogP1.54
Rot. Bonds3

About 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid

4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid (PubChem CID 77054962) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid
PubChem CID77054962
Molecular FormulaC12H10O4
Molecular Weight218.21 g/mol
Exact Mass218.06
IUPAC Name4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid
SMILESO=C(O)C=CC(=O)c1ccc2c(c1)COC2
InChIInChI=1S/C12H10O4/c13-11(3-4-12(14)15)8-1-2-9-6-16-7-10(9)5-8/h1-5H,6-7H2,(H,14,15)
InChIKeyRIMSVIRRANUSRG-UHFFFAOYSA-N
XLogP1.54
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.21
LogP ≤ 51.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid?
The IUPAC name of 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid (CID 77054962) is 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid?
The canonical SMILES for 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid is O=C(O)C=CC(=O)c1ccc2c(c1)COC2.
What is the InChIKey of 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid?
The InChIKey is RIMSVIRRANUSRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O4/c13-11(3-4-12(14)15)8-1-2-9-6-16-7-10(9)5-8/h1-5H,6-7H2,(H,14,15).
What are the key properties of 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid?
4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid has a molecular weight of 218.21 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dihydro-2-benzofuran-5-yl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 77054962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).