C7H13N5OS — CID 77064322
N'-hydroxy-3-[methyl(1,2,4-thiadiazol-5-yl)amino]butanimidamide (PubChem CID 77064322) has the molecular formula C7H13N5OS and a molecular weight of 215.28 g/mol. Its IUPAC name is N'-hydroxy-3-[methyl(1,2,4-thiadiazol-5-yl)amino]butanimidamide.
| Compound Name | N'-hydroxy-3-[methyl(1,2,4-thiadiazol-5-yl)amino]butanimidamide |
|---|---|
| PubChem CID | 77064322 |
| Molecular Formula | C7H13N5OS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | N'-hydroxy-3-[methyl(1,2,4-thiadiazol-5-yl)amino]butanimidamide |
| SMILES | CC(CC(N)=NO)N(C)c1ncns1 |
| InChI | InChI=1S/C7H13N5OS/c1-5(3-6(8)11-13)12(2)7-9-4-10-14-7/h4-5,13H,3H2,1-2H3,(H2,8,11) |
| InChIKey | IYMSHCZUGPJAQU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|