C9H9Cl2N5OS — CID 77067551
2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-N'-hydroxypropanimidamide (PubChem CID 77067551) has the molecular formula C9H9Cl2N5OS and a molecular weight of 306.18 g/mol. Its IUPAC name is 2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77067551 |
| Molecular Formula | C9H9Cl2N5OS |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | 2-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-N'-hydroxypropanimidamide |
| SMILES | CC(Nc1c(Cl)cc(Cl)c2nsnc12)C(N)=NO |
| InChI | InChI=1S/C9H9Cl2N5OS/c1-3(9(12)14-17)13-6-4(10)2-5(11)7-8(6)16-18-15-7/h2-3,13,17H,1H3,(H2,12,14) |
| InChIKey | JGARDEUYKCMMOB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|