C15H18O2S — CID 77075122
methyl 4-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-methylbut-2-enoate (PubChem CID 77075122) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is methyl 4-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-methylbut-2-enoate.
| Compound Name | methyl 4-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 77075122 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 4-(2,3-dihydro-1H-inden-5-ylsulfanyl)-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCSc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H18O2S/c1-11(15(16)17-2)8-9-18-14-7-6-12-4-3-5-13(12)10-14/h6-8,10H,3-5,9H2,1-2H3 |
| InChIKey | GJHNJVBKEMUAPC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|