C17H19ClFN3O — CID 77092054
N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-4-propylpyrimidine-5-carboxamide (PubChem CID 77092054) has the molecular formula C17H19ClFN3O and a molecular weight of 335.81 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-4-propylpyrimidine-5-carboxamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-4-propylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 77092054 |
| Molecular Formula | C17H19ClFN3O |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-4-propylpyrimidine-5-carboxamide |
| SMILES | CCCc1ncncc1C(=O)N(CC)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H19ClFN3O/c1-3-6-16-12(9-20-11-21-16)17(23)22(4-2)10-13-14(18)7-5-8-15(13)19/h5,7-9,11H,3-4,6,10H2,1-2H3 |
| InChIKey | ZLRZRSQLDPYFNA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |