C23H28N2O4 — CID 77172820
4-tert-butyl-N-[3-(2-hydroxyethylamino)-1-[4-(hydroxymethyl)phenyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 77172820) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-(2-hydroxyethylamino)-1-[4-(hydroxymethyl)phenyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-(2-hydroxyethylamino)-1-[4-(hydroxymethyl)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 77172820 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 4-tert-butyl-N-[3-(2-hydroxyethylamino)-1-[4-(hydroxymethyl)phenyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=Cc2ccc(CO)cc2)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-23(2,3)19-10-8-18(9-11-19)21(28)25-20(22(29)24-12-13-26)14-16-4-6-17(15-27)7-5-16/h4-11,14,26-27H,12-13,15H2,1-3H3,(H,24,29)(H,25,28) |
| InChIKey | WAZGSALYANDQOM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|