C22H24FN2O2+ — CID 7720349
4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-6,8-dimethylchromen-2-one (PubChem CID 7720349) has the molecular formula C22H24FN2O2+ and a molecular weight of 367.44 g/mol. Its IUPAC name is 4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-6,8-dimethylchromen-2-one.
| Compound Name | 4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-6,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 7720349 |
| Molecular Formula | C22H24FN2O2+ |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-6,8-dimethylchromen-2-one |
| SMILES | Cc1cc(C)c2oc(=O)cc(C[NH+]3CCN(c4ccccc4F)CC3)c2c1 |
| InChI | InChI=1S/C22H23FN2O2/c1-15-11-16(2)22-18(12-15)17(13-21(26)27-22)14-24-7-9-25(10-8-24)20-6-4-3-5-19(20)23/h3-6,11-13H,7-10,14H2,1-2H3/p+1 |
| InChIKey | VTOGFPKJFQZXNA-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|