C19H18Cl2O3 — CID 7723974
[2-(4-tert-butylphenyl)-2-oxoethyl] 3,5-dichlorobenzoate (PubChem CID 7723974) has the molecular formula C19H18Cl2O3 and a molecular weight of 365.26 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-2-oxoethyl] 3,5-dichlorobenzoate.
| Compound Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 7723974 |
| Molecular Formula | C19H18Cl2O3 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [2-(4-tert-butylphenyl)-2-oxoethyl] 3,5-dichlorobenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)COC(=O)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H18Cl2O3/c1-19(2,3)14-6-4-12(5-7-14)17(22)11-24-18(23)13-8-15(20)10-16(21)9-13/h4-10H,11H2,1-3H3 |
| InChIKey | AQLQNJMRNGAHQL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |