C17H15BrN2O2S — CID 77269730
3-benzyl-6-[(4-bromothiophen-3-yl)methylidene]-3-methylpiperazine-2,5-dione (PubChem CID 77269730) has the molecular formula C17H15BrN2O2S and a molecular weight of 391.29 g/mol. Its IUPAC name is 3-benzyl-6-[(4-bromothiophen-3-yl)methylidene]-3-methylpiperazine-2,5-dione.
| Compound Name | 3-benzyl-6-[(4-bromothiophen-3-yl)methylidene]-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 77269730 |
| Molecular Formula | C17H15BrN2O2S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 3-benzyl-6-[(4-bromothiophen-3-yl)methylidene]-3-methylpiperazine-2,5-dione |
| SMILES | CC1(Cc2ccccc2)NC(=O)C(=Cc2cscc2Br)NC1=O |
| InChI | InChI=1S/C17H15BrN2O2S/c1-17(8-11-5-3-2-4-6-11)16(22)19-14(15(21)20-17)7-12-9-23-10-13(12)18/h2-7,9-10H,8H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | QLJZFTAVCHPZKT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|