C19H22ClN3 — CID 77302013
N-[5-(3-chlorophenyl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 77302013) has the molecular formula C19H22ClN3 and a molecular weight of 327.86 g/mol. Its IUPAC name is N-[5-(3-chlorophenyl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[5-(3-chlorophenyl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 77302013 |
| Molecular Formula | C19H22ClN3 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[5-(3-chlorophenyl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | CC1C(Nc2ccc(-c3cccc(Cl)c3)cn2)C2CCN1CC2 |
| InChI | InChI=1S/C19H22ClN3/c1-13-19(14-7-9-23(13)10-8-14)22-18-6-5-16(12-21-18)15-3-2-4-17(20)11-15/h2-6,11-14,19H,7-10H2,1H3,(H,21,22) |
| InChIKey | NCIPHJJHKVFVRQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |