C19H20N2O5 — CID 7738318
1-butyl-3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 7738318) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-butyl-3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-butyl-3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7738318 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-butyl-3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CCCCN1C(=O)C(=O)N(Cc2cc(=O)oc3cc(C)c(C)cc23)C1=O |
| InChI | InChI=1S/C19H20N2O5/c1-4-5-6-20-17(23)18(24)21(19(20)25)10-13-9-16(22)26-15-8-12(3)11(2)7-14(13)15/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | SDAQHAZFQZSVGO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|