C27H31F5O — CID 77385915
1-[1,2-difluoro-3-(3-fluoro-4-propylphenoxy)propyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene (PubChem CID 77385915) has the molecular formula C27H31F5O and a molecular weight of 466.53 g/mol. Its IUPAC name is 1-[1,2-difluoro-3-(3-fluoro-4-propylphenoxy)propyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene.
| Compound Name | 1-[1,2-difluoro-3-(3-fluoro-4-propylphenoxy)propyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene |
|---|---|
| PubChem CID | 77385915 |
| Molecular Formula | C27H31F5O |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 1-[1,2-difluoro-3-(3-fluoro-4-propylphenoxy)propyl]-2,3-difluoro-4-(4-prop-1-enylcyclohexyl)benzene |
| SMILES | CC=CC1CCC(c2ccc(C(F)C(F)COc3ccc(CCC)c(F)c3)c(F)c2F)CC1 |
| InChI | InChI=1S/C27H31F5O/c1-3-5-17-7-9-18(10-8-17)21-13-14-22(27(32)26(21)31)25(30)24(29)16-33-20-12-11-19(6-4-2)23(28)15-20/h3,5,11-15,17-18,24-25H,4,6-10,16H2,1-2H3 |
| InChIKey | ARTNDTIGVFSBEX-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|