C15H18F3N4O+ — CID 7749311
7-methoxy-4-(4-methylpiperazin-4-ium-1-yl)-2-(trifluoromethyl)quinazoline (PubChem CID 7749311) has the molecular formula C15H18F3N4O+ and a molecular weight of 327.33 g/mol. Its IUPAC name is 7-methoxy-4-(4-methylpiperazin-4-ium-1-yl)-2-(trifluoromethyl)quinazoline.
| Compound Name | 7-methoxy-4-(4-methylpiperazin-4-ium-1-yl)-2-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 7749311 |
| Molecular Formula | C15H18F3N4O+ |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 7-methoxy-4-(4-methylpiperazin-4-ium-1-yl)-2-(trifluoromethyl)quinazoline |
| SMILES | COc1ccc2c(N3CC[NH+](C)CC3)nc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C15H17F3N4O/c1-21-5-7-22(8-6-21)13-11-4-3-10(23-2)9-12(11)19-14(20-13)15(16,17)18/h3-4,9H,5-8H2,1-2H3/p+1 |
| InChIKey | SVUBETOXXIPWJX-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |