C13H10F2N2O5 — CID 7757192
1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione (PubChem CID 7757192) has the molecular formula C13H10F2N2O5 and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7757192 |
| Molecular Formula | C13H10F2N2O5 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-3-methylimidazolidine-2,4,5-trione |
| SMILES | CN1C(=O)C(=O)N(CC(=O)c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C13H10F2N2O5/c1-16-10(19)11(20)17(13(16)21)6-9(18)7-2-4-8(5-3-7)22-12(14)15/h2-5,12H,6H2,1H3 |
| InChIKey | GDADBSRVGWOWDB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|