About [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate
[2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate (PubChem CID 7782971) has the molecular formula C20H15FO3
and a molecular weight of 322.34 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate.
Molecular Properties
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate |
| PubChem CID | 7782971 |
| Molecular Formula | C20H15FO3 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate |
| SMILES | O=C(Cc1cccc2ccccc12)OCC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H15FO3/c21-18-11-4-3-10-17(18)19(22)13-24-20(23)12-15-8-5-7-14-6-1-2-9-16(14)15/h1-11H,12-13H2 |
| InChIKey | WLFJDVFEOLYKBQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate?
The IUPAC name of [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate (CID 7782971) is [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate.
What is the SMILES notation for [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate?
The canonical SMILES for [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate is O=C(Cc1cccc2ccccc12)OCC(=O)c1ccccc1F.
What is the InChIKey of [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate?
The InChIKey is WLFJDVFEOLYKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15FO3/c21-18-11-4-3-10-17(18)19(22)13-24-20(23)12-15-8-5-7-14-6-1-2-9-16(14)15/h1-11H,12-13H2.
What are the key properties of [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate?
[2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate has a molecular weight of 322.34 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluorophenyl)-2-oxoethyl] 2-naphthalen-1-ylacetate is sourced from PubChem (CID 7782971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).