C20H19ClO3 — CID 7786951
[(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 7786951) has the molecular formula C20H19ClO3 and a molecular weight of 342.82 g/mol. Its IUPAC name is [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7786951 |
| Molecular Formula | C20H19ClO3 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | CCc1ccc(C(=O)[C@@H](C)OC(=O)/C=C/c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H19ClO3/c1-3-15-8-10-17(11-9-15)20(23)14(2)24-19(22)13-12-16-6-4-5-7-18(16)21/h4-14H,3H2,1-2H3/b13-12+/t14-/m1/s1 |
| InChIKey | DGPWDWMPLQJZHG-XTZCOPOCSA-N |
| XLogP | 4.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|