About [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate
[2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate (PubChem CID 7789499) has the molecular formula C16H10BrFN2O3S
and a molecular weight of 409.24 g/mol. Its IUPAC name is [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate |
| PubChem CID | 7789499 |
| Molecular Formula | C16H10BrFN2O3S |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate |
| SMILES | N#CSc1ccc(NC(=O)COC(=O)c2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C16H10BrFN2O3S/c17-13-7-12(24-9-19)5-6-14(13)20-15(21)8-23-16(22)10-1-3-11(18)4-2-10/h1-7H,8H2,(H,20,21) |
| InChIKey | HAPIDMVRIRJKPY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate?
The IUPAC name of [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate (CID 7789499) is [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate.
What is the SMILES notation for [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate?
The canonical SMILES for [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate is N#CSc1ccc(NC(=O)COC(=O)c2ccc(F)cc2)c(Br)c1.
What is the InChIKey of [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate?
The InChIKey is HAPIDMVRIRJKPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrFN2O3S/c17-13-7-12(24-9-19)5-6-14(13)20-15(21)8-23-16(22)10-1-3-11(18)4-2-10/h1-7H,8H2,(H,20,21).
What are the key properties of [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate?
[2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate has a molecular weight of 409.24 g/mol, XLogP of 3.96, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 4-fluorobenzoate is sourced from PubChem (CID 7789499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).