C12H11BrN2O4S — CID 8018828
[2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 2-methoxyacetate (PubChem CID 8018828) has the molecular formula C12H11BrN2O4S and a molecular weight of 359.20 g/mol. Its IUPAC name is [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 2-methoxyacetate.
| Compound Name | [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 8018828 |
| Molecular Formula | C12H11BrN2O4S |
| Molecular Weight | 359.20 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | [2-(2-bromo-4-thiocyanatoanilino)-2-oxoethyl] 2-methoxyacetate |
| SMILES | COCC(=O)OCC(=O)Nc1ccc(SC#N)cc1Br |
| InChI | InChI=1S/C12H11BrN2O4S/c1-18-6-12(17)19-5-11(16)15-10-3-2-8(20-7-14)4-9(10)13/h2-4H,5-6H2,1H3,(H,15,16) |
| InChIKey | WHVASPZPFCVBRK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|