C18H31NO3 — CID 78044114
1-(6-hydroxy-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-1-yl)ethanone (PubChem CID 78044114) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-(6-hydroxy-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-1-yl)ethanone.
| Compound Name | 1-(6-hydroxy-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 78044114 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | 1-(6-hydroxy-7-methoxy-3,5-dimethyl-1-azacyclotetradeca-3,8-dien-1-yl)ethanone |
| SMILES | COC1C=CCCCCCN(C(C)=O)CC(C)=CC(C)C1O |
| InChI | InChI=1S/C18H31NO3/c1-14-12-15(2)18(21)17(22-4)10-8-6-5-7-9-11-19(13-14)16(3)20/h8,10,12,15,17-18,21H,5-7,9,11,13H2,1-4H3 |
| InChIKey | JYBBMWLYWSTSJX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|