C13H25N2O4Si — CID 78060548
N,N-Diethyl-6-oxo-8,11-dioxa-5-aza-1-silatridecan-13-amide (PubChem CID 78060548) has the molecular formula C13H25N2O4Si and a molecular weight of 301.44 g/mol.
| Compound Name | N,N-Diethyl-6-oxo-8,11-dioxa-5-aza-1-silatridecan-13-amide |
|---|---|
| PubChem CID | 78060548 |
| Molecular Formula | C13H25N2O4Si |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)COCCOCC(=O)NCCC[Si] |
| InChI | InChI=1S/C13H25N2O4Si/c1-3-15(4-2)13(17)11-19-8-7-18-10-12(16)14-6-5-9-20/h3-11H2,1-2H3,(H,14,16) |
| InChIKey | KECBMRMUBHJKHA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|