About 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane
2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane (PubChem CID 145161931) has the molecular formula C10H22N2O5
and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane.
Molecular Properties
| Compound Name | 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane |
| PubChem CID | 145161931 |
| Molecular Formula | C10H22N2O5 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane |
| SMILES | CC.CCCCNC(=O)COCCO[N+](=O)[O-] |
| InChI | InChI=1S/C8H16N2O5.C2H6/c1-2-3-4-9-8(11)7-14-5-6-15-10(12)13;1-2/h2-7H2,1H3,(H,9,11);1-2H3 |
| InChIKey | YNFFTAQGRBJOFK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane?
The IUPAC name of 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane (CID 145161931) is 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane.
What is the SMILES notation for 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane?
The canonical SMILES for 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane is CC.CCCCNC(=O)COCCO[N+](=O)[O-].
What is the InChIKey of 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane?
The InChIKey is YNFFTAQGRBJOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O5.C2H6/c1-2-3-4-9-8(11)7-14-5-6-15-10(12)13;1-2/h2-7H2,1H3,(H,9,11);1-2H3.
What are the key properties of 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane?
2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane has a molecular weight of 250.29 g/mol, XLogP of 1.15, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(butylamino)-2-oxoethoxy]ethyl nitrate;ethane is sourced from PubChem (CID 145161931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).