About {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane
{9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane (PubChem CID 78066907) has the molecular formula C16H34O2Si
and a molecular weight of 286.53 g/mol.
Molecular Properties
| Compound Name | {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane |
| PubChem CID | 78066907 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | — |
| SMILES | C[Si]CCCCCCCCC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H34O2Si/c1-14(2)17-16(18-15(3)4)12-10-8-6-7-9-11-13-19-5/h14-16H,6-13H2,1-5H3 |
| InChIKey | HXVVSYUUSRCQRD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane?
The IUPAC name of {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane (CID 78066907) is not available.
What is the SMILES notation for {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane?
The canonical SMILES for {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane is C[Si]CCCCCCCCC(OC(C)C)OC(C)C.
What is the InChIKey of {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane?
The InChIKey is HXVVSYUUSRCQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2Si/c1-14(2)17-16(18-15(3)4)12-10-8-6-7-9-11-13-19-5/h14-16H,6-13H2,1-5H3.
What are the key properties of {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane?
{9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane has a molecular weight of 286.53 g/mol, XLogP of 5.06, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for {9,9-Bis[(propan-2-yl)oxy]nonyl}(methyl)silane is sourced from PubChem (CID 78066907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).