C8H9F5O2 — CID 78088573
1-ethoxy-4,4,5,5,5-pentafluoro-2-methylpent-1-en-3-one (PubChem CID 78088573) has the molecular formula C8H9F5O2 and a molecular weight of 232.15 g/mol. Its IUPAC name is 1-ethoxy-4,4,5,5,5-pentafluoro-2-methylpent-1-en-3-one.
| Compound Name | 1-ethoxy-4,4,5,5,5-pentafluoro-2-methylpent-1-en-3-one |
|---|---|
| PubChem CID | 78088573 |
| Molecular Formula | C8H9F5O2 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-ethoxy-4,4,5,5,5-pentafluoro-2-methylpent-1-en-3-one |
| SMILES | CCOC=C(C)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5O2/c1-3-15-4-5(2)6(14)7(9,10)8(11,12)13/h4H,3H2,1-2H3 |
| InChIKey | ZOVBCJZQXJNBOU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|