C17H26O5 — CID 78097917
[2-hydroxy-2-(5-hydroxy-4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl)propyl] acetate (PubChem CID 78097917) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is [2-hydroxy-2-(5-hydroxy-4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl)propyl] acetate.
| Compound Name | [2-hydroxy-2-(5-hydroxy-4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl)propyl] acetate |
|---|---|
| PubChem CID | 78097917 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [2-hydroxy-2-(5-hydroxy-4a,8-dimethyl-7-oxo-1,2,3,4,5,6-hexahydronaphthalen-2-yl)propyl] acetate |
| SMILES | CC(=O)OCC(C)(O)C1CCC2(C)C(=C(C)C(=O)CC2O)C1 |
| InChI | InChI=1S/C17H26O5/c1-10-13-7-12(17(4,21)9-22-11(2)18)5-6-16(13,3)15(20)8-14(10)19/h12,15,20-21H,5-9H2,1-4H3 |
| InChIKey | RSMPVABNCXYPQH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |