C50H95N3O12 — CID 78111774
2-[5-(35-butyl-10,12,14,16,18,22,26,30,34-nonahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine (PubChem CID 78111774) has the molecular formula C50H95N3O12 and a molecular weight of 930.32 g/mol. Its IUPAC name is 2-[5-(35-butyl-10,12,14,16,18,22,26,30,34-nonahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine.
| Compound Name | 2-[5-(35-butyl-10,12,14,16,18,22,26,30,34-nonahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine |
|---|---|
| PubChem CID | 78111774 |
| Molecular Formula | C50H95N3O12 |
| Molecular Weight | 930.32 g/mol |
| Exact Mass | 929.69 |
| IUPAC Name | 2-[5-(35-butyl-10,12,14,16,18,22,26,30,34-nonahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl)-4-hydroxyhexyl]guanidine |
| SMILES | CCCCC1C(=O)OC(C(C)C(O)CCCN=C(N)N)C(C)C=C(C)CCCCC(O)CC(O)CC(O)CC(O)CC(O)CC=C(C)C(O)CCCC(O)CCCC(O)CCC(C)C1O |
| InChI | InChI=1S/C50H95N3O12/c1-7-8-19-44-47(63)34(4)23-24-38(55)17-11-16-37(54)18-12-20-45(61)33(3)22-25-40(57)29-42(59)31-43(60)30-41(58)28-39(56)15-10-9-14-32(2)27-35(5)48(65-49(44)64)36(6)46(62)21-13-26-53-50(51)52/h22,27,34-48,54-63H,7-21,23-26,28-31H2,1-6H3,(H4,51,52,53) |
| InChIKey | MTSOQIYWDSVDTR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 293.00 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|