C52H99N3O13 — CID 71557153
2-[5-[(4E,20E)-35-hexyl-10,12,14,16,18,19,22,26,30,34-decahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl]-4-hydroxyhexyl]guanidine (PubChem CID 71557153) has the molecular formula C52H99N3O13 and a molecular weight of 974.37 g/mol. Its IUPAC name is 2-[5-[(4E,20E)-35-hexyl-10,12,14,16,18,19,22,26,30,34-decahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl]-4-hydroxyhexyl]guanidine.
| Compound Name | 2-[5-[(4E,20E)-35-hexyl-10,12,14,16,18,19,22,26,30,34-decahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl]-4-hydroxyhexyl]guanidine |
|---|---|
| PubChem CID | 71557153 |
| Molecular Formula | C52H99N3O13 |
| Molecular Weight | 974.37 g/mol |
| Exact Mass | 973.72 |
| IUPAC Name | 2-[5-[(4E,20E)-35-hexyl-10,12,14,16,18,19,22,26,30,34-decahydroxy-3,5,21,33-tetramethyl-36-oxo-1-oxacyclohexatriaconta-4,20-dien-2-yl]-4-hydroxyhexyl]guanidine |
| SMILES | CCCCCCC1C(=O)OC(C(C)C(O)CCCN=C(N)N)C(C)/C=C(/C)CCCCC(O)CC(O)CC(O)CC(O)CC(O)C(O)/C=C(/C)C(O)CCCC(O)CCCC(O)CCC(C)C1O |
| InChI | InChI=1S/C52H99N3O13/c1-7-8-9-10-21-44-49(66)34(3)24-25-39(57)19-13-18-38(56)20-14-22-45(62)35(4)28-47(64)48(65)32-43(61)31-42(60)30-41(59)29-40(58)17-12-11-16-33(2)27-36(5)50(68-51(44)67)37(6)46(63)23-15-26-55-52(53)54/h27-28,34,36-50,56-66H,7-26,29-32H2,1-6H3,(H4,53,54,55)/b33-27-,35-28- |
| InChIKey | PTRKLJDOSMBWQQ-TWMZOGGISA-N |
| XLogP | 4.56 |
| TPSA | 313.23 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|