C51H97N3O13 — CID 10373708
2-[3-[(6E,22E)-4,12,14,16,18,20,21,24,28,32,36-undecahydroxy-3,5,7,23,35-pentamethyl-38-oxo-37-pentyl-1-oxacyclooctatriaconta-6,22-dien-2-yl]propyl]guanidine (PubChem CID 10373708) has the molecular formula C51H97N3O13 and a molecular weight of 960.34 g/mol. Its IUPAC name is 2-[3-[(6E,22E)-4,12,14,16,18,20,21,24,28,32,36-undecahydroxy-3,5,7,23,35-pentamethyl-38-oxo-37-pentyl-1-oxacyclooctatriaconta-6,22-dien-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(6E,22E)-4,12,14,16,18,20,21,24,28,32,36-undecahydroxy-3,5,7,23,35-pentamethyl-38-oxo-37-pentyl-1-oxacyclooctatriaconta-6,22-dien-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 10373708 |
| Molecular Formula | C51H97N3O13 |
| Molecular Weight | 960.34 g/mol |
| Exact Mass | 959.70 |
| IUPAC Name | 2-[3-[(6E,22E)-4,12,14,16,18,20,21,24,28,32,36-undecahydroxy-3,5,7,23,35-pentamethyl-38-oxo-37-pentyl-1-oxacyclooctatriaconta-6,22-dien-2-yl]propyl]guanidine |
| SMILES | CCCCCC1C(=O)OC(CCCN=C(N)N)C(C)C(O)C(C)/C=C(/C)CCCCC(O)CC(O)CC(O)CC(O)CC(O)C(O)/C=C(/C)C(O)CCCC(O)CCCC(O)CCC(C)C1O |
| InChI | InChI=1S/C51H97N3O13/c1-7-8-9-20-43-49(65)33(3)23-24-38(56)18-12-17-37(55)19-13-21-44(61)34(4)27-45(62)46(63)31-42(60)30-41(59)29-40(58)28-39(57)16-11-10-15-32(2)26-35(5)48(64)36(6)47(67-50(43)66)22-14-25-54-51(52)53/h26-27,33,35-49,55-65H,7-25,28-31H2,1-6H3,(H4,52,53,54)/b32-26-,34-27- |
| InChIKey | FWJDNVXSNHUMEU-URLVWOCSSA-N |
| XLogP | 4.17 |
| TPSA | 313.23 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|