C23H26ClN3O3 — CID 78165025
1-tert-butyl-3-[[5-chloro-3-(oxan-2-yloxymethyl)-2-pyridinyl]methylidene]pyrrolo[2,3-b]pyridin-2-one (PubChem CID 78165025) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 1-tert-butyl-3-[[5-chloro-3-(oxan-2-yloxymethyl)-2-pyridinyl]methylidene]pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 1-tert-butyl-3-[[5-chloro-3-(oxan-2-yloxymethyl)-2-pyridinyl]methylidene]pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 78165025 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-tert-butyl-3-[[5-chloro-3-(oxan-2-yloxymethyl)-2-pyridinyl]methylidene]pyrrolo[2,3-b]pyridin-2-one |
| SMILES | CC(C)(C)N1C(=O)C(=Cc2ncc(Cl)cc2COC2CCCCO2)c2cccnc21 |
| InChI | InChI=1S/C23H26ClN3O3/c1-23(2,3)27-21-17(7-6-9-25-21)18(22(27)28)12-19-15(11-16(24)13-26-19)14-30-20-8-4-5-10-29-20/h6-7,9,11-13,20H,4-5,8,10,14H2,1-3H3 |
| InChIKey | AOLNHOMUAOZTFE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|