C10H15N6O2+ — CID 78172495
8-hydrazinyl-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione (PubChem CID 78172495) has the molecular formula C10H15N6O2+ and a molecular weight of 251.27 g/mol. Its IUPAC name is 8-hydrazinyl-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-hydrazinyl-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78172495 |
| Molecular Formula | C10H15N6O2+ |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 8-hydrazinyl-1,3-dimethyl-7-prop-2-enyl-5H-purin-7-ium-2,6-dione |
| SMILES | C=CC[N+]1=C(NN)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C10H14N6O2/c1-4-5-16-6-7(12-9(16)13-11)14(2)10(18)15(3)8(6)17/h4,6H,1,5,11H2,2-3H3/p+1 |
| InChIKey | BQKOKKRPJYCKAF-UHFFFAOYSA-O |
| XLogP | -1.69 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|