C12H16N5O2+ — CID 78172369
2,4-dimethyl-6-prop-2-enyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione (PubChem CID 78172369) has the molecular formula C12H16N5O2+ and a molecular weight of 262.29 g/mol. Its IUPAC name is 2,4-dimethyl-6-prop-2-enyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione.
| Compound Name | 2,4-dimethyl-6-prop-2-enyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione |
|---|---|
| PubChem CID | 78172369 |
| Molecular Formula | C12H16N5O2+ |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2,4-dimethyl-6-prop-2-enyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-1,3-dione |
| SMILES | C=CC[N+]1=C2N=C3C(C(=O)N(C)C(=O)N3C)N2CC1 |
| InChI | InChI=1S/C12H16N5O2/c1-4-5-16-6-7-17-8-9(13-11(16)17)14(2)12(19)15(3)10(8)18/h4,8H,1,5-7H2,2-3H3/q+1 |
| InChIKey | NOAZLDBRPMQWOC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|