C13H22N5O2+ — CID 73328331
[1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-dimethylazanium (PubChem CID 73328331) has the molecular formula C13H22N5O2+ and a molecular weight of 280.35 g/mol. Its IUPAC name is [1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-dimethylazanium.
| Compound Name | [1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 73328331 |
| Molecular Formula | C13H22N5O2+ |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [1,3-dimethyl-7-(2-methylpropyl)-2,6-dioxo-5H-purin-8-ylidene]-dimethylazanium |
| SMILES | CC(C)CN1C(=[N+](C)C)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H22N5O2/c1-8(2)7-18-9-10(14-12(18)15(3)4)16(5)13(20)17(6)11(9)19/h8-9H,7H2,1-6H3/q+1 |
| InChIKey | PTVBHLVUFNITBR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|