C11H13BrN5O3+ — CID 78204633
2-(8-bromo-3-methyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetamide (PubChem CID 78204633) has the molecular formula C11H13BrN5O3+ and a molecular weight of 343.16 g/mol. Its IUPAC name is 2-(8-bromo-3-methyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetamide.
| Compound Name | 2-(8-bromo-3-methyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 78204633 |
| Molecular Formula | C11H13BrN5O3+ |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 2-(8-bromo-3-methyl-2,6-dioxo-7-prop-2-enyl-5H-purin-7-ium-1-yl)acetamide |
| SMILES | C=CC[N+]1=C(Br)N=C2C1C(=O)N(CC(N)=O)C(=O)N2C |
| InChI | InChI=1S/C11H12BrN5O3/c1-3-4-16-7-8(14-10(16)12)15(2)11(20)17(9(7)19)5-6(13)18/h3,7H,1,4-5H2,2H3,(H-,13,18)/p+1 |
| InChIKey | MCCYMZMDFZSTDR-UHFFFAOYSA-O |
| XLogP | -0.90 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|