C9H11BrN4O2 — CID 78201755
8-bromo-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione (PubChem CID 78201755) has the molecular formula C9H11BrN4O2 and a molecular weight of 287.12 g/mol. Its IUPAC name is 8-bromo-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-bromo-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78201755 |
| Molecular Formula | C9H11BrN4O2 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 8-bromo-3-methyl-7-prop-2-enyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1C(Br)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C9H11BrN4O2/c1-3-4-14-5-6(11-8(14)10)13(2)9(16)12-7(5)15/h3,5-6H,1,4H2,2H3,(H,12,15,16) |
| InChIKey | SXDUWGAXDKQLQD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|