C8H9BrN4O3 — CID 45053508
2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetaldehyde (PubChem CID 45053508) has the molecular formula C8H9BrN4O3 and a molecular weight of 289.09 g/mol. Its IUPAC name is 2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetaldehyde.
| Compound Name | 2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetaldehyde |
|---|---|
| PubChem CID | 45053508 |
| Molecular Formula | C8H9BrN4O3 |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-(8-bromo-3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetaldehyde |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(Br)N2CC=O |
| InChI | InChI=1S/C8H9BrN4O3/c1-12-5-4(6(15)11-8(12)16)13(2-3-14)7(9)10-5/h3-5H,2H2,1H3,(H,11,15,16) |
| InChIKey | PPQKDKFTMZNXLK-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|