C15H23N7O3 — CID 73329026
2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide (PubChem CID 73329026) has the molecular formula C15H23N7O3 and a molecular weight of 349.40 g/mol. Its IUPAC name is 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide.
| Compound Name | 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 73329026 |
| Molecular Formula | C15H23N7O3 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-[4-(3-methyl-2,6-dioxo-7-prop-2-enyl-4,5-dihydropurin-8-yl)piperazin-1-yl]acetamide |
| SMILES | C=CCN1C(N2CCN(CC(N)=O)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C15H23N7O3/c1-3-4-22-11-12(19(2)15(25)18-13(11)24)17-14(22)21-7-5-20(6-8-21)9-10(16)23/h3,11-12H,1,4-9H2,2H3,(H2,16,23)(H,18,24,25) |
| InChIKey | HZXXXQIYICBGDV-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|