C9H12Br2N4O2 — CID 73279160
8-bromo-7-(2-bromopropyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 73279160) has the molecular formula C9H12Br2N4O2 and a molecular weight of 368.03 g/mol. Its IUPAC name is 8-bromo-7-(2-bromopropyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-bromo-7-(2-bromopropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 73279160 |
| Molecular Formula | C9H12Br2N4O2 |
| Molecular Weight | 368.03 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 8-bromo-7-(2-bromopropyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CC(Br)CN1C(Br)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C9H12Br2N4O2/c1-4(10)3-15-5-6(12-8(15)11)14(2)9(17)13-7(5)16/h4-6H,3H2,1-2H3,(H,13,16,17) |
| InChIKey | JNTTYNSGAXOUKS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.03 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|