C10H10N6O2S3 — CID 78294855
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methylidene-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetamide (PubChem CID 78294855) has the molecular formula C10H10N6O2S3 and a molecular weight of 342.43 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methylidene-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methylidene-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 78294855 |
| Molecular Formula | C10H10N6O2S3 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(6-methylidene-5-oxo-1,2,4-triazin-3-yl)sulfanyl]acetamide |
| SMILES | C=C1N=NC(SCC(=O)Nc2nnc(SCC)s2)=NC1=O |
| InChI | InChI=1S/C10H10N6O2S3/c1-3-19-10-16-15-9(21-10)11-6(17)4-20-8-12-7(18)5(2)13-14-8/h2-4H2,1H3,(H,11,15,17) |
| InChIKey | RMZABSDYEZGBMK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|