C23H27BrN4O2S — CID 78356574
4-[(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)methyl]-N-[2-[butyl(methyl)amino]ethyl]benzamide (PubChem CID 78356574) has the molecular formula C23H27BrN4O2S and a molecular weight of 503.47 g/mol. Its IUPAC name is 4-[(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)methyl]-N-[2-[butyl(methyl)amino]ethyl]benzamide.
| Compound Name | 4-[(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)methyl]-N-[2-[butyl(methyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 78356574 |
| Molecular Formula | C23H27BrN4O2S |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 4-[(6-bromo-4-oxo-2-sulfanylidene-4aH-quinazolin-3-yl)methyl]-N-[2-[butyl(methyl)amino]ethyl]benzamide |
| SMILES | CCCCN(C)CCNC(=O)c1ccc(CN2C(=O)C3C=C(Br)C=CC3=NC2=S)cc1 |
| InChI | InChI=1S/C23H27BrN4O2S/c1-3-4-12-27(2)13-11-25-21(29)17-7-5-16(6-8-17)15-28-22(30)19-14-18(24)9-10-20(19)26-23(28)31/h5-10,14,19H,3-4,11-13,15H2,1-2H3,(H,25,29) |
| InChIKey | BXFFJTGGSCETAA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|